C23H21ClN4O3S — CID 18843651
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 18843651) has the molecular formula C23H21ClN4O3S and a molecular weight of 468.97 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843651 |
| Molecular Formula | C23H21ClN4O3S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/C=C/c2ccccc2[N+](=O)[O-])S/C(=N\c2cccnc2Cl)N1C1CCCCC1 |
| InChI | InChI=1S/C23H21ClN4O3S/c24-21-18(12-7-15-25-21)26-23-27(17-10-2-1-3-11-17)22(29)20(32-23)14-6-9-16-8-4-5-13-19(16)28(30)31/h4-9,12-15,17H,1-3,10-11H2/b9-6+,20-14-,26-23- |
| InChIKey | WXKBGBJQSJGUEG-XRAUUXSGSA-N |
| XLogP | 6.14 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|