C24H29N3O3S — CID 5168295
3-cyclohexyl-2-cyclohexylimino-5-[3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 5168295) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5168295 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=CC=Cc2ccccc2[N+](=O)[O-])S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C24H29N3O3S/c28-23-22(17-9-11-18-10-7-8-16-21(18)27(29)30)31-24(25-19-12-3-1-4-13-19)26(23)20-14-5-2-6-15-20/h7-11,16-17,19-20H,1-6,12-15H2/b11-9?,22-17?,25-24- |
| InChIKey | KGCQNMRGPZMREG-GPIIWZHASA-N |
| XLogP | 6.09 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|