C23H29N3O4S — CID 3958799
3-cyclohexyl-2-cyclohexylimino-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 3958799) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3958799 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=C1S/C(=N\C2CCCCC2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C23H29N3O4S/c1-30-20-13-12-19(26(28)29)14-16(20)15-21-22(27)25(18-10-6-3-7-11-18)23(31-21)24-17-8-4-2-5-9-17/h12-15,17-18H,2-11H2,1H3/b21-15?,24-23- |
| InChIKey | XUYJCBHRIWLZBL-RUDNBLMXSA-N |
| XLogP | 5.54 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|