C26H34N2O5S — CID 126251468
(2R)-2-[2-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126251468) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is (2R)-2-[2-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126251468 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (2R)-2-[2-[(Z)-(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C2\S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C26H34N2O5S/c1-17(25(30)31)33-23-18(10-9-15-21(23)32-2)16-22-24(29)28(20-13-7-4-8-14-20)26(34-22)27-19-11-5-3-6-12-19/h9-10,15-17,19-20H,3-8,11-14H2,1-2H3,(H,30,31)/b22-16-,27-26-/t17-/m1/s1 |
| InChIKey | QLEXMWFASXQRGT-MULJJZGSSA-N |
| XLogP | 5.48 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|