C21H21N5O3S2 — CID 18846199
(2E,5Z)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 18846199) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is (2E,5Z)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18846199 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (2E,5Z)-3-cyclohexyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1nnc(/N=C2/S/C(=C\C=C\c3ccccc3[N+](=O)[O-])C(=O)N2C2CCCCC2)s1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-14-23-24-20(30-14)22-21-25(16-10-3-2-4-11-16)19(27)18(31-21)13-7-9-15-8-5-6-12-17(15)26(28)29/h5-9,12-13,16H,2-4,10-11H2,1H3/b9-7+,18-13-,22-21+ |
| InChIKey | RZIIYXLEORAKMH-ROMPQOGUSA-N |
| XLogP | 5.25 |
| TPSA | 101.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|