C24H17Cl2NO3S — CID 18840885
(5Z)-3-(3,4-dichlorophenyl)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18840885) has the molecular formula C24H17Cl2NO3S and a molecular weight of 470.38 g/mol. Its IUPAC name is (5Z)-3-(3,4-dichlorophenyl)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3,4-dichlorophenyl)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840885 |
| Molecular Formula | C24H17Cl2NO3S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | (5Z)-3-(3,4-dichlorophenyl)-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(COc2ccccc2/C=C2\SC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H17Cl2NO3S/c1-15-6-8-16(9-7-15)14-30-21-5-3-2-4-17(21)12-22-23(28)27(24(29)31-22)18-10-11-19(25)20(26)13-18/h2-13H,14H2,1H3/b22-12- |
| InChIKey | DNTQATOOIGDVMN-UUYOSTAYSA-N |
| XLogP | 7.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|