C23H13BrCl3NO3S — CID 126194642
(5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126194642) has the molecular formula C23H13BrCl3NO3S and a molecular weight of 569.69 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126194642 |
| Molecular Formula | C23H13BrCl3NO3S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 566.89 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H13BrCl3NO3S/c24-15-2-8-20(31-12-13-1-7-18(26)19(27)9-13)14(10-15)11-21-22(29)28(23(30)32-21)17-5-3-16(25)4-6-17/h1-11H,12H2/b21-11+ |
| InChIKey | HEMXDBJSTLLSEX-SRZZPIQSSA-N |
| XLogP | 8.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|