C24H15BrClNO5S — CID 126195250
4-[[4-bromo-2-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126195250) has the molecular formula C24H15BrClNO5S and a molecular weight of 544.81 g/mol. Its IUPAC name is 4-[[4-bromo-2-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-bromo-2-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126195250 |
| Molecular Formula | C24H15BrClNO5S |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 542.95 |
| IUPAC Name | 4-[[4-bromo-2-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(Br)cc2/C=C2/SC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H15BrClNO5S/c25-17-5-10-20(32-13-14-1-3-15(4-2-14)23(29)30)16(11-17)12-21-22(28)27(24(31)33-21)19-8-6-18(26)7-9-19/h1-12H,13H2,(H,29,30)/b21-12+ |
| InChIKey | MRWAAHNZBZNTFH-CIAFOILYSA-N |
| XLogP | 6.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|