C26H19BrClNO6S — CID 126196138
4-[[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126196138) has the molecular formula C26H19BrClNO6S and a molecular weight of 588.86 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126196138 |
| Molecular Formula | C26H19BrClNO6S |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 586.98 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(c3ccc(Cl)cc3)C2=O)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H19BrClNO6S/c1-2-34-21-12-16(11-20(27)23(21)35-14-15-3-5-17(6-4-15)25(31)32)13-22-24(30)29(26(33)36-22)19-9-7-18(28)8-10-19/h3-13H,2,14H2,1H3,(H,31,32)/b22-13+ |
| InChIKey | KFOGDRZKIJKFMJ-LPYMAVHISA-N |
| XLogP | 7.02 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|