C29H26BrNO6S — CID 126138170
4-[[2-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126138170) has the molecular formula C29H26BrNO6S and a molecular weight of 596.50 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126138170 |
| Molecular Formula | C29H26BrNO6S |
| Molecular Weight | 596.50 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H26BrNO6S/c1-2-36-24-16-21(15-23(30)26(24)37-18-20-10-12-22(13-11-20)28(33)34)17-25-27(32)31(29(35)38-25)14-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-13,15-17H,2,6,9,14,18H2,1H3,(H,33,34)/b25-17+ |
| InChIKey | YRDYHECHELAZSG-KOEQRZSOSA-N |
| XLogP | 6.79 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|