C24H25BrN2O5S — CID 21168520
4-[[2-bromo-6-ethoxy-4-[(E)-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 21168520) has the molecular formula C24H25BrN2O5S and a molecular weight of 533.44 g/mol. Its IUPAC name is 4-[[2-bromo-6-ethoxy-4-[(E)-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-ethoxy-4-[(E)-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21168520 |
| Molecular Formula | C24H25BrN2O5S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 4-[[2-bromo-6-ethoxy-4-[(E)-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | CC/N=C1\S/C(=C/c2cc(Br)c(OCc3ccc(C(=O)O)cc3)c(OCC)c2)C(=O)N1CC |
| InChI | InChI=1S/C24H25BrN2O5S/c1-4-26-24-27(5-2)22(28)20(33-24)13-16-11-18(25)21(19(12-16)31-6-3)32-14-15-7-9-17(10-8-15)23(29)30/h7-13H,4-6,14H2,1-3H3,(H,29,30)/b20-13+,26-24- |
| InChIKey | MWSXDMKKAPDLEL-GQKMNLJRSA-N |
| XLogP | 5.44 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|