C21H17BrClNO6S — CID 126196683
methyl 2-[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 126196683) has the molecular formula C21H17BrClNO6S and a molecular weight of 526.79 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126196683 |
| Molecular Formula | C21H17BrClNO6S |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 524.96 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(c3ccc(Cl)cc3)C2=O)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C21H17BrClNO6S/c1-3-29-16-9-12(8-15(22)19(16)30-11-18(25)28-2)10-17-20(26)24(21(27)31-17)14-6-4-13(23)5-7-14/h4-10H,3,11H2,1-2H3/b17-10+ |
| InChIKey | NNBYEYLOMRKQJQ-LICLKQGHSA-N |
| XLogP | 5.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|