C34H37IN2O3S — CID 3609170
3-cyclohexyl-2-cyclohexylimino-5-[[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 3609170) has the molecular formula C34H37IN2O3S and a molecular weight of 680.65 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3609170 |
| Molecular Formula | C34H37IN2O3S |
| Molecular Weight | 680.65 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc(I)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H37IN2O3S/c1-39-30-20-24(19-29(35)32(30)40-22-23-16-17-25-10-8-9-11-26(25)18-23)21-31-33(38)37(28-14-6-3-7-15-28)34(41-31)36-27-12-4-2-5-13-27/h8-11,16-21,27-28H,2-7,12-15,22H2,1H3/b31-21?,36-34- |
| InChIKey | JSXCFECAHIAYRM-LVZLRGANSA-N |
| XLogP | 8.97 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.65 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|