C33H32BrN3O2S — CID 4195050
5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-cyclohexyl-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 4195050) has the molecular formula C33H32BrN3O2S and a molecular weight of 614.61 g/mol. Its IUPAC name is 5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-cyclohexyl-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-cyclohexyl-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4195050 |
| Molecular Formula | C33H32BrN3O2S |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | 5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-cyclohexyl-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2\SC(=Cc3cn(Cc4ccccc4)c4ccc(Br)cc34)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C33H32BrN3O2S/c1-2-39-28-16-14-26(15-17-28)35-33-37(27-11-7-4-8-12-27)32(38)31(40-33)19-24-22-36(21-23-9-5-3-6-10-23)30-18-13-25(34)20-29(24)30/h3,5-6,9-10,13-20,22,27H,2,4,7-8,11-12,21H2,1H3/b31-19?,35-33- |
| InChIKey | NPURKHRYDQWAKJ-MJMGHEMPSA-N |
| XLogP | 8.79 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|