C33H26FN3OS — CID 6372657
(5E)-3-benzyl-2-benzylimino-5-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 6372657) has the molecular formula C33H26FN3OS and a molecular weight of 531.66 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6372657 |
| Molecular Formula | C33H26FN3OS |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cn(Cc3ccc(F)cc3)c3ccccc23)S/C(=N\Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H26FN3OS/c34-28-17-15-26(16-18-28)21-36-23-27(29-13-7-8-14-30(29)36)19-31-32(38)37(22-25-11-5-2-6-12-25)33(39-31)35-20-24-9-3-1-4-10-24/h1-19,23H,20-22H2/b31-19+,35-33- |
| InChIKey | SPARDBSDRJSHNK-RXLUXOEMSA-N |
| XLogP | 7.50 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|