C22H21N3O2S — CID 71945351
2-[2-[(3-butyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetonitrile (PubChem CID 71945351) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-[2-[(3-butyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[(3-butyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 71945351 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[2-[(3-butyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetonitrile |
| SMILES | CCCCN1C(=O)C(=Cc2ccccc2OCC#N)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-2-3-14-25-21(26)20(28-22(25)24-18-10-5-4-6-11-18)16-17-9-7-8-12-19(17)27-15-13-23/h4-12,16H,2-3,14-15H2,1H3/b20-16?,24-22- |
| InChIKey | LLZNUETVPRLAMW-MEXBPEPLSA-N |
| XLogP | 4.99 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|