C22H21N3O3S — CID 4570767
2-[2-[[2-(4-methoxyphenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 4570767) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[2-[[2-(4-methoxyphenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[[2-(4-methoxyphenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 4570767 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[2-[[2-(4-methoxyphenyl)imino-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | CCCN1C(=O)C(=Cc2ccccc2OCC#N)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-3-13-25-21(26)20(15-16-6-4-5-7-19(16)28-14-12-23)29-22(25)24-17-8-10-18(27-2)11-9-17/h4-11,15H,3,13-14H2,1-2H3/b20-15?,24-22- |
| InChIKey | CQAVLRBWHBFBDU-UBXODTPDSA-N |
| XLogP | 4.61 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|