C17H15N3O5S — CID 3650688
methyl 2-[5-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3650688) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is methyl 2-[5-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[5-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3650688 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | methyl 2-[5-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)SC(=Cc2cn(CC(N)=O)c3ccccc23)C1=O |
| InChI | InChI=1S/C17H15N3O5S/c1-25-15(22)9-20-16(23)13(26-17(20)24)6-10-7-19(8-14(18)21)12-5-3-2-4-11(10)12/h2-7H,8-9H2,1H3,(H2,18,21) |
| InChIKey | GSVDTQWTRULNNB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|