C22H23N3O5S — CID 3895925
methyl 2-[3-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate (PubChem CID 3895925) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 2-[3-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 3895925 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | methyl 2-[3-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(C=C2SC(=O)N(CC(=O)N3CCCCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O5S/c1-30-20(27)14-24-12-15(16-7-3-4-8-17(16)24)11-18-21(28)25(22(29)31-18)13-19(26)23-9-5-2-6-10-23/h3-4,7-8,11-12H,2,5-6,9-10,13-14H2,1H3 |
| InChIKey | DJDXHAJANQSVJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|