C27H27N3O3S — CID 126130473
(5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126130473) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126130473 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)S/C(=C\c3cn(CC(=O)N4CCCCCC4)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-19-10-12-21(13-11-19)30-26(32)24(34-27(30)33)16-20-17-29(23-9-5-4-8-22(20)23)18-25(31)28-14-6-2-3-7-15-28/h4-5,8-13,16-17H,2-3,6-7,14-15,18H2,1H3/b24-16- |
| InChIKey | JLKABEXNZOFLBX-JLPGSUDCSA-N |
| XLogP | 5.59 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|