C26H18N3O3S- — CID 6289240
2-[3-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate (PubChem CID 6289240) has the molecular formula C26H18N3O3S- and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[3-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | 2-[3-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 6289240 |
| Molecular Formula | C26H18N3O3S- |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[3-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetate |
| SMILES | O=C([O-])Cn1cc(/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H19N3O3S/c30-24(31)17-28-16-18(21-13-7-8-14-22(21)28)15-23-25(32)29(20-11-5-2-6-12-20)26(33-23)27-19-9-3-1-4-10-19/h1-16H,17H2,(H,30,31)/p-1/b23-15-,27-26- |
| InChIKey | QIEDPFOXYMLHQS-WTTGCPTKSA-M |
| XLogP | 4.20 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|