C20H17N3O2S — CID 50853614
(5E)-3-(furan-2-ylmethyl)-5-[(1-methylpyrrol-3-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50853614) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is (5E)-3-(furan-2-ylmethyl)-5-[(1-methylpyrrol-3-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(furan-2-ylmethyl)-5-[(1-methylpyrrol-3-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50853614 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (5E)-3-(furan-2-ylmethyl)-5-[(1-methylpyrrol-3-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cn1ccc(/C=C2/S/C(=N\c3ccccc3)N(Cc3ccco3)C2=O)c1 |
| InChI | InChI=1S/C20H17N3O2S/c1-22-10-9-15(13-22)12-18-19(24)23(14-17-8-5-11-25-17)20(26-18)21-16-6-3-2-4-7-16/h2-13H,14H2,1H3/b18-12+,21-20- |
| InChIKey | XXDMTKIKLJJWKL-KDWIEBRMSA-N |
| XLogP | 4.42 |
| TPSA | 50.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|