C16H11BrFNO — CID 2060019
5-bromo-1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde (PubChem CID 2060019) has the molecular formula C16H11BrFNO and a molecular weight of 332.17 g/mol. Its IUPAC name is 5-bromo-1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde.
| Compound Name | 5-bromo-1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 2060019 |
| Molecular Formula | C16H11BrFNO |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 5-bromo-1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn(Cc2ccccc2F)c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H11BrFNO/c17-13-5-6-16-14(7-13)12(10-20)9-19(16)8-11-3-1-2-4-15(11)18/h1-7,9-10H,8H2 |
| InChIKey | JCTLQONXXMOFSN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|