C15H10BrFN2O — CID 66415838
1-[(5-bromo-2-fluorophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 66415838) has the molecular formula C15H10BrFN2O and a molecular weight of 333.16 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 66415838 |
| Molecular Formula | C15H10BrFN2O |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1cn(Cc2cc(Br)ccc2F)c2ncccc12 |
| InChI | InChI=1S/C15H10BrFN2O/c16-12-3-4-14(17)10(6-12)7-19-8-11(9-20)13-2-1-5-18-15(13)19/h1-6,8-9H,7H2 |
| InChIKey | RSLOKLNCXCQVLH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|