C13H9BrN2OS — CID 66414474
1-[(5-bromothiophen-2-yl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 66414474) has the molecular formula C13H9BrN2OS and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 66414474 |
| Molecular Formula | C13H9BrN2OS |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1cn(Cc2ccc(Br)s2)c2ncccc12 |
| InChI | InChI=1S/C13H9BrN2OS/c14-12-4-3-10(18-12)7-16-6-9(8-17)11-2-1-5-15-13(11)16/h1-6,8H,7H2 |
| InChIKey | XTZMKKNTRPHYOC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|