C16H11N3O — CID 66415845
2-[(3-formylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzonitrile (PubChem CID 66415845) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(3-formylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzonitrile.
| Compound Name | 2-[(3-formylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 66415845 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[(3-formylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1cc(C=O)c2cccnc21 |
| InChI | InChI=1S/C16H11N3O/c17-8-12-4-1-2-5-13(12)9-19-10-14(11-20)15-6-3-7-18-16(15)19/h1-7,10-11H,9H2 |
| InChIKey | XHJVZAOECSIPGZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|