C28H24ClFN2O4S — CID 126379065
2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126379065) has the molecular formula C28H24ClFN2O4S and a molecular weight of 539.03 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126379065 |
| Molecular Formula | C28H24ClFN2O4S |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 2-[(5E)-5-[[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN2C(=O)S/C(=C/c3cccc(OCc4c(F)cccc4Cl)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C28H24ClFN2O4S/c1-16-10-17(2)26(18(3)11-16)31-25(33)14-32-27(34)24(37-28(32)35)13-19-6-4-7-20(12-19)36-15-21-22(29)8-5-9-23(21)30/h4-13H,14-15H2,1-3H3,(H,31,33)/b24-13+ |
| InChIKey | QOEJUXDZTPTFPL-ZMOGYAJESA-N |
| XLogP | 6.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|