C21H26BrNO6S — CID 126221243
[(2S)-butan-2-yl] 2-[(5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126221243) has the molecular formula C21H26BrNO6S and a molecular weight of 500.41 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-[(5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2S)-butan-2-yl] 2-[(5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126221243 |
| Molecular Formula | C21H26BrNO6S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | [(2S)-butan-2-yl] 2-[(5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCOc1c(Br)cc(/C=C2\SC(=O)N(CC(=O)O[C@@H](C)CC)C2=O)cc1OCC |
| InChI | InChI=1S/C21H26BrNO6S/c1-5-8-28-19-15(22)9-14(10-16(19)27-7-3)11-17-20(25)23(21(26)30-17)12-18(24)29-13(4)6-2/h9-11,13H,5-8,12H2,1-4H3/b17-11-/t13-/m0/s1 |
| InChIKey | ZKBCPXBGCFYZER-MFVBVHDHSA-N |
| XLogP | 5.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|