C23H20BrCl2NO5S — CID 126202367
[(2R)-butan-2-yl] 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126202367) has the molecular formula C23H20BrCl2NO5S and a molecular weight of 573.29 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126202367 |
| Molecular Formula | C23H20BrCl2NO5S |
| Molecular Weight | 573.29 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)CN1C(=O)S/C(=C/c2ccc(OCc3ccc(Cl)cc3Cl)c(Br)c2)C1=O |
| InChI | InChI=1S/C23H20BrCl2NO5S/c1-3-13(2)32-21(28)11-27-22(29)20(33-23(27)30)9-14-4-7-19(17(24)8-14)31-12-15-5-6-16(25)10-18(15)26/h4-10,13H,3,11-12H2,1-2H3/b20-9+/t13-/m1/s1 |
| InChIKey | UADQROLIPKIGCX-PCQWDSEFSA-N |
| XLogP | 6.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|