C18H13NO5S — CID 126230258
(5E)-5-[(3,4-dihydroxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126230258) has the molecular formula C18H13NO5S and a molecular weight of 355.37 g/mol. Its IUPAC name is (5E)-5-[(3,4-dihydroxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,4-dihydroxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126230258 |
| Molecular Formula | C18H13NO5S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (5E)-5-[(3,4-dihydroxyphenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(O)c(O)c2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C18H13NO5S/c20-13-7-6-11(8-14(13)21)9-16-17(23)19(18(24)25-16)10-15(22)12-4-2-1-3-5-12/h1-9,20-21H,10H2/b16-9+ |
| InChIKey | IRUPSPHFUSQAON-CXUHLZMHSA-N |
| XLogP | 3.02 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|