C16H16FNO4S — CID 71832648
tert-butyl 2-[5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 71832648) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is tert-butyl 2-[5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 71832648 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | tert-butyl 2-[5-[(3-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)SC(=Cc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H16FNO4S/c1-16(2,3)22-13(19)9-18-14(20)12(23-15(18)21)8-10-5-4-6-11(17)7-10/h4-8H,9H2,1-3H3 |
| InChIKey | SFDHEDCPQDSOQJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|