C18H21NO6S — CID 6490507
tert-butyl 2-[(5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 6490507) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is tert-butyl 2-[(5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 6490507 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | tert-butyl 2-[(5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)OC(C)(C)C)C2=O)ccc1O |
| InChI | InChI=1S/C18H21NO6S/c1-5-24-13-8-11(6-7-12(13)20)9-14-16(22)19(17(23)26-14)10-15(21)25-18(2,3)4/h6-9,20H,5,10H2,1-4H3/b14-9+ |
| InChIKey | ZTVAUKVTSRJXGA-NTEUORMPSA-N |
| XLogP | 3.17 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|