C20H24N2O4S — CID 6385306
tert-butyl 2-[(5E)-2,4-dioxo-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 6385306) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is tert-butyl 2-[(5E)-2,4-dioxo-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(5E)-2,4-dioxo-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 6385306 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | tert-butyl 2-[(5E)-2,4-dioxo-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)S/C(=C/c2ccc(N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C20H24N2O4S/c1-20(2,3)26-17(23)13-22-18(24)16(27-19(22)25)12-14-6-8-15(9-7-14)21-10-4-5-11-21/h6-9,12H,4-5,10-11,13H2,1-3H3/b16-12+ |
| InChIKey | GOFBLLLFEAAVQH-FOWTUZBSSA-N |
| XLogP | 3.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|