C25H24FIN2O7S — CID 3555424
tert-butyl 2-[5-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3555424) has the molecular formula C25H24FIN2O7S and a molecular weight of 642.44 g/mol. Its IUPAC name is tert-butyl 2-[5-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3555424 |
| Molecular Formula | C25H24FIN2O7S |
| Molecular Weight | 642.44 g/mol |
| Exact Mass | 642.03 |
| IUPAC Name | tert-butyl 2-[5-[[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FIN2O7S/c1-25(2,3)36-21(31)12-29-23(32)19(37-24(29)33)11-14-9-17(27)22(18(10-14)34-4)35-13-20(30)28-16-7-5-15(26)6-8-16/h5-11H,12-13H2,1-4H3,(H,28,30) |
| InChIKey | JDKDPODOFCBCOT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|