C19H23INO4+ — CID 2237530
[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methyl-(2-phenylethyl)azanium (PubChem CID 2237530) has the molecular formula C19H23INO4+ and a molecular weight of 456.30 g/mol. Its IUPAC name is [3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methyl-(2-phenylethyl)azanium.
| Compound Name | [3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 2237530 |
| Molecular Formula | C19H23INO4+ |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methyl-(2-phenylethyl)azanium |
| SMILES | COC(=O)COc1c(I)cc(C[NH2+]CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22INO4/c1-23-17-11-15(10-16(20)19(17)25-13-18(22)24-2)12-21-9-8-14-6-4-3-5-7-14/h3-7,10-11,21H,8-9,12-13H2,1-2H3/p+1 |
| InChIKey | LXQVJAIQWQVCQB-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|