C22H31N2O3+ — CID 7372063
butyl-[[3-methoxy-4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methyl]azanium (PubChem CID 7372063) has the molecular formula C22H31N2O3+ and a molecular weight of 371.50 g/mol. Its IUPAC name is butyl-[[3-methoxy-4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methyl]azanium.
| Compound Name | butyl-[[3-methoxy-4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 7372063 |
| Molecular Formula | C22H31N2O3+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | butyl-[[3-methoxy-4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methyl]azanium |
| SMILES | CCCC[NH2+]Cc1ccc(OCC(=O)NCCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-3-4-13-23-16-19-10-11-20(21(15-19)26-2)27-17-22(25)24-14-12-18-8-6-5-7-9-18/h5-11,15,23H,3-4,12-14,16-17H2,1-2H3,(H,24,25)/p+1 |
| InChIKey | YRUMQXLEOGWVAJ-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|