C21H31N3O3+2 — CID 7315153
2-[[4-[2-(benzylamino)-2-oxoethoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium (PubChem CID 7315153) has the molecular formula C21H31N3O3+2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[[4-[2-(benzylamino)-2-oxoethoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium.
| Compound Name | 2-[[4-[2-(benzylamino)-2-oxoethoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7315153 |
| Molecular Formula | C21H31N3O3+2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-[[4-[2-(benzylamino)-2-oxoethoxy]-3-methoxyphenyl]methylazaniumyl]ethyl-dimethylazanium |
| SMILES | COc1cc(C[NH2+]CC[NH+](C)C)ccc1OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-24(2)12-11-22-14-18-9-10-19(20(13-18)26-3)27-16-21(25)23-15-17-7-5-4-6-8-17/h4-10,13,22H,11-12,14-16H2,1-3H3,(H,23,25)/p+2 |
| InChIKey | MXYPAGUASQVTSW-UHFFFAOYSA-P |
| XLogP | -0.40 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|