C26H21NO5 — CID 1020513
N-benzyl-2-[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 1020513) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-benzyl-2-[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-benzyl-2-[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 1020513 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-benzyl-2-[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)ccc1OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H21NO5/c1-31-23-14-18(13-21-25(29)19-9-5-6-10-20(19)26(21)30)11-12-22(23)32-16-24(28)27-15-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3,(H,27,28) |
| InChIKey | LJPRNEVOTZNJGN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|