C17H18N2O4 — CID 57365590
N-benzyl-2-[4-(hydroxyiminomethyl)-2-methoxyphenoxy]acetamide (PubChem CID 57365590) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-benzyl-2-[4-(hydroxyiminomethyl)-2-methoxyphenoxy]acetamide.
| Compound Name | N-benzyl-2-[4-(hydroxyiminomethyl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 57365590 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-benzyl-2-[4-(hydroxyiminomethyl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=NO)ccc1OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O4/c1-22-16-9-14(11-19-21)7-8-15(16)23-12-17(20)18-10-13-5-3-2-4-6-13/h2-9,11,21H,10,12H2,1H3,(H,18,20) |
| InChIKey | DYXVBBLFFMYKLF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|