C24H23ClN4O3S — CID 16553739
2-[4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 16553739) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is 2-[4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 16553739 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[4-[(E)-(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | COc1cc(/C=N/NC(=S)NCc2ccccc2)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClN4O3S/c1-31-22-13-18(15-27-29-24(33)26-14-17-7-3-2-4-8-17)11-12-21(22)32-16-23(30)28-20-10-6-5-9-19(20)25/h2-13,15H,14,16H2,1H3,(H,28,30)(H2,26,29,33)/b27-15+ |
| InChIKey | IKORJSUSTYGHRE-JFLMPSFJSA-N |
| XLogP | 4.36 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|