C14H21NO4 — CID 60627689
N-butyl-2-[4-(hydroxymethyl)-2-methoxyphenoxy]acetamide (PubChem CID 60627689) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is N-butyl-2-[4-(hydroxymethyl)-2-methoxyphenoxy]acetamide.
| Compound Name | N-butyl-2-[4-(hydroxymethyl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 60627689 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-butyl-2-[4-(hydroxymethyl)-2-methoxyphenoxy]acetamide |
| SMILES | CCCCNC(=O)COc1ccc(CO)cc1OC |
| InChI | InChI=1S/C14H21NO4/c1-3-4-7-15-14(17)10-19-12-6-5-11(9-16)8-13(12)18-2/h5-6,8,16H,3-4,7,9-10H2,1-2H3,(H,15,17) |
| InChIKey | DONNOIFFPDWDFQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|