C17H16INO5 — CID 55771551
methyl 2-[4-[(4-iodophenyl)carbamoyl]-2-methoxyphenoxy]acetate (PubChem CID 55771551) has the molecular formula C17H16INO5 and a molecular weight of 441.22 g/mol. Its IUPAC name is methyl 2-[4-[(4-iodophenyl)carbamoyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(4-iodophenyl)carbamoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 55771551 |
| Molecular Formula | C17H16INO5 |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | methyl 2-[4-[(4-iodophenyl)carbamoyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)Nc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C17H16INO5/c1-22-15-9-11(3-8-14(15)24-10-16(20)23-2)17(21)19-13-6-4-12(18)5-7-13/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | FSQFUONQXUPAOD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|