C16H15IN2O3S — CID 1181777
N-[(4-iodophenyl)carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 1181777) has the molecular formula C16H15IN2O3S and a molecular weight of 442.28 g/mol. Its IUPAC name is N-[(4-iodophenyl)carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4-iodophenyl)carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1181777 |
| Molecular Formula | C16H15IN2O3S |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | N-[(4-iodophenyl)carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C16H15IN2O3S/c1-21-13-8-3-10(9-14(13)22-2)15(20)19-16(23)18-12-6-4-11(17)5-7-12/h3-9H,1-2H3,(H2,18,19,20,23) |
| InChIKey | HPOOQXKAJAIAED-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|