C17H16N2O6S — CID 28688479
4-[(3,4-dimethoxybenzoyl)carbamothioylamino]-2-hydroxybenzoic acid (PubChem CID 28688479) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is 4-[(3,4-dimethoxybenzoyl)carbamothioylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3,4-dimethoxybenzoyl)carbamothioylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 28688479 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 4-[(3,4-dimethoxybenzoyl)carbamothioylamino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)O)c(O)c2)cc1OC |
| InChI | InChI=1S/C17H16N2O6S/c1-24-13-6-3-9(7-14(13)25-2)15(21)19-17(26)18-10-4-5-11(16(22)23)12(20)8-10/h3-8,20H,1-2H3,(H,22,23)(H2,18,19,21,26) |
| InChIKey | QTHHAQPZKAEKSW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|