C23H20ClNO6 — CID 55772777
methyl 2-[5-[[4-(2-chlorophenoxy)phenyl]carbamoyl]-2-methoxyphenoxy]acetate (PubChem CID 55772777) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is methyl 2-[5-[[4-(2-chlorophenoxy)phenyl]carbamoyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-[[4-(2-chlorophenoxy)phenyl]carbamoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 55772777 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | methyl 2-[5-[[4-(2-chlorophenoxy)phenyl]carbamoyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(C(=O)Nc2ccc(Oc3ccccc3Cl)cc2)ccc1OC |
| InChI | InChI=1S/C23H20ClNO6/c1-28-20-12-7-15(13-21(20)30-14-22(26)29-2)23(27)25-16-8-10-17(11-9-16)31-19-6-4-3-5-18(19)24/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | HYYQFRQDOJSSOY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |