C24H21Cl2NO5 — CID 70984916
ethyl 2-[3-chloro-4-[4-[(4-chloro-3-methoxybenzoyl)amino]phenoxy]phenyl]acetate (PubChem CID 70984916) has the molecular formula C24H21Cl2NO5 and a molecular weight of 474.34 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-[4-[(4-chloro-3-methoxybenzoyl)amino]phenoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-[4-[(4-chloro-3-methoxybenzoyl)amino]phenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 70984916 |
| Molecular Formula | C24H21Cl2NO5 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | ethyl 2-[3-chloro-4-[4-[(4-chloro-3-methoxybenzoyl)amino]phenoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Oc2ccc(NC(=O)c3ccc(Cl)c(OC)c3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2NO5/c1-3-31-23(28)13-15-4-11-21(20(26)12-15)32-18-8-6-17(7-9-18)27-24(29)16-5-10-19(25)22(14-16)30-2/h4-12,14H,3,13H2,1-2H3,(H,27,29) |
| InChIKey | GQJOCHACMUZCGL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |