C25H21ClN2O5 — CID 143840555
ethyl 2-[3-chloro-4-[4-[(5-hydroxy-1H-indole-2-carbonyl)amino]phenoxy]phenyl]acetate (PubChem CID 143840555) has the molecular formula C25H21ClN2O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-[4-[(5-hydroxy-1H-indole-2-carbonyl)amino]phenoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-[4-[(5-hydroxy-1H-indole-2-carbonyl)amino]phenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 143840555 |
| Molecular Formula | C25H21ClN2O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | ethyl 2-[3-chloro-4-[4-[(5-hydroxy-1H-indole-2-carbonyl)amino]phenoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Oc2ccc(NC(=O)c3cc4cc(O)ccc4[nH]3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H21ClN2O5/c1-2-32-24(30)12-15-3-10-23(20(26)11-15)33-19-7-4-17(5-8-19)27-25(31)22-14-16-13-18(29)6-9-21(16)28-22/h3-11,13-14,28-29H,2,12H2,1H3,(H,27,31) |
| InChIKey | UEZAASJFYJFHSI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |