C26H22ClNO5 — CID 70985006
ethyl 2-[3-chloro-4-[4-[(3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]phenyl]acetate (PubChem CID 70985006) has the molecular formula C26H22ClNO5 and a molecular weight of 463.92 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-[4-[(3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-chloro-4-[4-[(3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 70985006 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | ethyl 2-[3-chloro-4-[4-[(3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Oc2ccc(NC(=O)c3oc4ccccc4c3C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H22ClNO5/c1-3-31-24(29)15-17-8-13-23(21(27)14-17)32-19-11-9-18(10-12-19)28-26(30)25-16(2)20-6-4-5-7-22(20)33-25/h4-14H,3,15H2,1-2H3,(H,28,30) |
| InChIKey | IIWHVAIPWQXDKO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |