C25H19BrClNO5 — CID 70985035
ethyl 2-[4-[4-[(5-bromo-1-benzofuran-2-carbonyl)amino]phenoxy]-3-chlorophenyl]acetate (PubChem CID 70985035) has the molecular formula C25H19BrClNO5 and a molecular weight of 528.79 g/mol. Its IUPAC name is ethyl 2-[4-[4-[(5-bromo-1-benzofuran-2-carbonyl)amino]phenoxy]-3-chlorophenyl]acetate.
| Compound Name | ethyl 2-[4-[4-[(5-bromo-1-benzofuran-2-carbonyl)amino]phenoxy]-3-chlorophenyl]acetate |
|---|---|
| PubChem CID | 70985035 |
| Molecular Formula | C25H19BrClNO5 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | ethyl 2-[4-[4-[(5-bromo-1-benzofuran-2-carbonyl)amino]phenoxy]-3-chlorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Oc2ccc(NC(=O)c3cc4cc(Br)ccc4o3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H19BrClNO5/c1-2-31-24(29)12-15-3-9-22(20(27)11-15)32-19-7-5-18(6-8-19)28-25(30)23-14-16-13-17(26)4-10-21(16)33-23/h3-11,13-14H,2,12H2,1H3,(H,28,30) |
| InChIKey | QBJLMRHWTNFBAG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |