C20H20BrNO3 — CID 19225305
5-bromo-N-(4-pentoxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 19225305) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is 5-bromo-N-(4-pentoxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(4-pentoxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19225305 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 5-bromo-N-(4-pentoxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=O)c2cc3cc(Br)ccc3o2)cc1 |
| InChI | InChI=1S/C20H20BrNO3/c1-2-3-4-11-24-17-8-6-16(7-9-17)22-20(23)19-13-14-12-15(21)5-10-18(14)25-19/h5-10,12-13H,2-4,11H2,1H3,(H,22,23) |
| InChIKey | QADPBWGACOQRQO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|